C9H9N3O3S — CID 80572410
2-(2-cyanomorpholin-4-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 80572410) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-(2-cyanomorpholin-4-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-cyanomorpholin-4-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80572410 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-(2-cyanomorpholin-4-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | N#CC1CN(c2ncc(C(=O)O)s2)CCO1 |
| InChI | InChI=1S/C9H9N3O3S/c10-3-6-5-12(1-2-15-6)9-11-4-7(16-9)8(13)14/h4,6H,1-2,5H2,(H,13,14) |
| InChIKey | TWDCNELFFGJBAC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |