2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid

C9H12N2O3S — CID 71208672

IUPAC2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(N2CCC(O)CC2)s1
InChIInChI=1S/C9H12N2O3S/c12-6-1-3-11(4-2-6)9-10-5-7(15-9)8(13)14/h5-6,12H,1-4H2,(H,13,14)
InChIKeyZVHYQAXFETYKTA-UHFFFAOYSA-N
MW228.27 g/mol
LogP0.80
Rot. Bonds2

About 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid

2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 71208672) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid
PubChem CID71208672
Molecular FormulaC9H12N2O3S
Molecular Weight228.27 g/mol
Exact Mass228.06
IUPAC Name2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(N2CCC(O)CC2)s1
InChIInChI=1S/C9H12N2O3S/c12-6-1-3-11(4-2-6)9-10-5-7(15-9)8(13)14/h5-6,12H,1-4H2,(H,13,14)
InChIKeyZVHYQAXFETYKTA-UHFFFAOYSA-N
XLogP0.80
TPSA73.66 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.27
LogP ≤ 50.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid (CID 71208672) is 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(N2CCC(O)CC2)s1.
What is the InChIKey of 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is ZVHYQAXFETYKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c12-6-1-3-11(4-2-6)9-10-5-7(15-9)8(13)14/h5-6,12H,1-4H2,(H,13,14).
What are the key properties of 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid?
2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 228.27 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxypiperidin-1-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 71208672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).