C14H14ClN3O2S — CID 62753823
2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid (PubChem CID 62753823) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 62753823 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCN(c3cccc(Cl)c3)CC2)s1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-10-2-1-3-11(8-10)17-4-6-18(7-5-17)14-16-9-12(21-14)13(19)20/h1-3,8-9H,4-7H2,(H,19,20) |
| InChIKey | SOKXBGQUNMMOTJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |