C9H12N2OS — CID 62756912
1-(2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 62756912) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 62756912 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(2-pyrrolidin-1-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1cnc(N2CCCC2)s1 |
| InChI | InChI=1S/C9H12N2OS/c1-7(12)8-6-10-9(13-8)11-4-2-3-5-11/h6H,2-5H2,1H3 |
| InChIKey | HSBVRKFFBXKQMY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |