C9H14N4OS — CID 83579539
N-methyl-2-piperazin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 83579539) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is N-methyl-2-piperazin-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-methyl-2-piperazin-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 83579539 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-methyl-2-piperazin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1cnc(N2CCNCC2)s1 |
| InChI | InChI=1S/C9H14N4OS/c1-10-8(14)7-6-12-9(15-7)13-4-2-11-3-5-13/h6,11H,2-5H2,1H3,(H,10,14) |
| InChIKey | KPAYFHPLBMJTAU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |