C5H7N3OS — CID 56609316
2-(methylamino)-1,3-thiazole-5-carboxamide (PubChem CID 56609316) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is 2-(methylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(methylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56609316 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2-(methylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CNc1ncc(C(N)=O)s1 |
| InChI | InChI=1S/C5H7N3OS/c1-7-5-8-2-3(10-5)4(6)9/h2H,1H3,(H2,6,9)(H,7,8) |
| InChIKey | IWOZCIPAARHROL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |