C9H12N2O2S2 — CID 80571882
methyl 2-thiomorpholin-4-yl-1,3-thiazole-5-carboxylate (PubChem CID 80571882) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is methyl 2-thiomorpholin-4-yl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-thiomorpholin-4-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80571882 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | methyl 2-thiomorpholin-4-yl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCSCC2)s1 |
| InChI | InChI=1S/C9H12N2O2S2/c1-13-8(12)7-6-10-9(15-7)11-2-4-14-5-3-11/h6H,2-5H2,1H3 |
| InChIKey | ZHOJZLFVHBQDRA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |