C16H17N3O3S — CID 69199219
methyl 2-(4-benzoylpiperazin-1-yl)-1,3-thiazole-5-carboxylate (PubChem CID 69199219) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is methyl 2-(4-benzoylpiperazin-1-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(4-benzoylpiperazin-1-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 69199219 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl 2-(4-benzoylpiperazin-1-yl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCN(C(=O)c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C16H17N3O3S/c1-22-15(21)13-11-17-16(23-13)19-9-7-18(8-10-19)14(20)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3 |
| InChIKey | RWNSNWYEEZNILF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |