C19H24N4O3S — CID 172659954
methyl 2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-thiazole-5-carboxylate (PubChem CID 172659954) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl 2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 172659954 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl 2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2C[C@H]3C[C@@H](Nc4ccccn4)[C@H](OC)C[C@H]3C2)s1 |
| InChI | InChI=1S/C19H24N4O3S/c1-25-15-8-13-11-23(19-21-9-16(27-19)18(24)26-2)10-12(13)7-14(15)22-17-5-3-4-6-20-17/h3-6,9,12-15H,7-8,10-11H2,1-2H3,(H,20,22)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | RDTURSNVAIFISU-LXTVHRRPSA-N |
| XLogP | 2.67 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |