C26H34N4O2 — CID 172658705
[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone (PubChem CID 172658705) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 172658705 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(4-piperidin-4-ylphenyl)methanone |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3ccc(C4CCNCC4)cc3)C[C@H]2C[C@H]1Nc1ccccn1 |
| InChI | InChI=1S/C26H34N4O2/c1-32-24-15-22-17-30(16-21(22)14-23(24)29-25-4-2-3-11-28-25)26(31)20-7-5-18(6-8-20)19-9-12-27-13-10-19/h2-8,11,19,21-24,27H,9-10,12-17H2,1H3,(H,28,29)/t21-,22+,23-,24-/m1/s1 |
| InChIKey | QJXUARHOVIUWQF-UEQSERJNSA-N |
| XLogP | 3.53 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |