C22H28N4O3 — CID 172663239
2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1,6-dimethylpyridin-4-one (PubChem CID 172663239) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1,6-dimethylpyridin-4-one.
| Compound Name | 2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1,6-dimethylpyridin-4-one |
|---|---|
| PubChem CID | 172663239 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1,6-dimethylpyridin-4-one |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3cc(=O)cc(C)n3C)C[C@H]2C[C@H]1Nc1ccccn1 |
| InChI | InChI=1S/C22H28N4O3/c1-14-8-17(27)11-19(25(14)2)22(28)26-12-15-9-18(20(29-3)10-16(15)13-26)24-21-6-4-5-7-23-21/h4-8,11,15-16,18,20H,9-10,12-13H2,1-3H3,(H,23,24)/t15-,16+,18-,20-/m1/s1 |
| InChIKey | TVDODJDDDCOPQH-YNVMFWSZSA-N |
| XLogP | 2.07 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |