C19H26N6OS — CID 172656974
(3aS,5R,6R,7aR)-2-(6-amino-2-methylsulfanylpyrimidin-4-yl)-6-methoxy-N-pyridin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 172656974) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-2-(6-amino-2-methylsulfanylpyrimidin-4-yl)-6-methoxy-N-pyridin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aS,5R,6R,7aR)-2-(6-amino-2-methylsulfanylpyrimidin-4-yl)-6-methoxy-N-pyridin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 172656974 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (3aS,5R,6R,7aR)-2-(6-amino-2-methylsulfanylpyrimidin-4-yl)-6-methoxy-N-pyridin-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CO[C@@H]1C[C@H]2CN(c3cc(N)nc(SC)n3)C[C@H]2C[C@H]1Nc1ccccn1 |
| InChI | InChI=1S/C19H26N6OS/c1-26-15-8-13-11-25(18-9-16(20)23-19(24-18)27-2)10-12(13)7-14(15)22-17-5-3-4-6-21-17/h3-6,9,12-15H,7-8,10-11H2,1-2H3,(H,21,22)(H2,20,23,24)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | SAYRKTFEAUZXGT-LXTVHRRPSA-N |
| XLogP | 2.52 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |