C22H26N6O2 — CID 172664944
[(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylimidazo[4,5-b]pyridin-7-yl)methanone (PubChem CID 172664944) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylimidazo[4,5-b]pyridin-7-yl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylimidazo[4,5-b]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 172664944 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-methoxy-6-(pyridin-2-ylamino)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylimidazo[4,5-b]pyridin-7-yl)methanone |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3ccnc4c3ncn4C)C[C@H]2C[C@H]1Nc1ccccn1 |
| InChI | InChI=1S/C22H26N6O2/c1-27-13-25-20-16(6-8-24-21(20)27)22(29)28-11-14-9-17(18(30-2)10-15(14)12-28)26-19-5-3-4-7-23-19/h3-8,13-15,17-18H,9-12H2,1-2H3,(H,23,26)/t14-,15+,17-,18-/m1/s1 |
| InChIKey | PYCXLNULAPONBL-CYGHRXIMSA-N |
| XLogP | 2.34 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |