C8H11N3O2S3 — CID 125488442
3-(5-nitro-1,3-thiazol-2-yl)-1,5,3-dithiazocane (PubChem CID 125488442) has the molecular formula C8H11N3O2S3 and a molecular weight of 277.40 g/mol. Its IUPAC name is 3-(5-nitro-1,3-thiazol-2-yl)-1,5,3-dithiazocane.
| Compound Name | 3-(5-nitro-1,3-thiazol-2-yl)-1,5,3-dithiazocane |
|---|---|
| PubChem CID | 125488442 |
| Molecular Formula | C8H11N3O2S3 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 3-(5-nitro-1,3-thiazol-2-yl)-1,5,3-dithiazocane |
| SMILES | O=[N+]([O-])c1cnc(N2CSCCCSC2)s1 |
| InChI | InChI=1S/C8H11N3O2S3/c12-11(13)7-4-9-8(16-7)10-5-14-2-1-3-15-6-10/h4H,1-3,5-6H2 |
| InChIKey | JOYPSEAHRVVHMG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|