C10H13N3O4S — CID 102771809
methyl 1-(5-nitro-1,3-thiazol-2-yl)piperidine-3-carboxylate (PubChem CID 102771809) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is methyl 1-(5-nitro-1,3-thiazol-2-yl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(5-nitro-1,3-thiazol-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 102771809 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | methyl 1-(5-nitro-1,3-thiazol-2-yl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2ncc([N+](=O)[O-])s2)C1 |
| InChI | InChI=1S/C10H13N3O4S/c1-17-9(14)7-3-2-4-12(6-7)10-11-5-8(18-10)13(15)16/h5,7H,2-4,6H2,1H3 |
| InChIKey | OGVXCHAARQPHHT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|