C15H18AcN5O2S- — CID 59036757
actinium;[4-[[4-(5-nitro-1,3-thiazol-2-yl)piperazin-1-yl]methyl]phenyl]methylazanide (PubChem CID 59036757) has the molecular formula C15H18AcN5O2S- and a molecular weight of 559.41 g/mol. Its IUPAC name is actinium;[4-[[4-(5-nitro-1,3-thiazol-2-yl)piperazin-1-yl]methyl]phenyl]methylazanide.
| Compound Name | actinium;[4-[[4-(5-nitro-1,3-thiazol-2-yl)piperazin-1-yl]methyl]phenyl]methylazanide |
|---|---|
| PubChem CID | 59036757 |
| Molecular Formula | C15H18AcN5O2S- |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | actinium;[4-[[4-(5-nitro-1,3-thiazol-2-yl)piperazin-1-yl]methyl]phenyl]methylazanide |
| SMILES | [Ac].[NH-]Cc1ccc(CN2CCN(c3ncc([N+](=O)[O-])s3)CC2)cc1 |
| InChI | InChI=1S/C15H18N5O2S.Ac/c16-9-12-1-3-13(4-2-12)11-18-5-7-19(8-6-18)15-17-10-14(23-15)20(21)22;/h1-4,10,16H,5-9,11H2;/q-1; |
| InChIKey | AERGBHQLLACTIZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|