C15H18N4O2S — CID 11631108
2-(4-benzylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-5-carboxamide (PubChem CID 11631108) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 11631108 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-hydroxy-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCN(Cc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C15H18N4O2S/c20-14(17-21)13-10-16-15(22-13)19-8-6-18(7-9-19)11-12-4-2-1-3-5-12/h1-5,10,21H,6-9,11H2,(H,17,20) |
| InChIKey | HGKGJEZYUNSVHC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|