C15H17N3O4S2 — CID 90969521
2-(4-benzylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 90969521) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-(4-benzylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-benzylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 90969521 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-(4-benzylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCN(S(=O)(=O)Cc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C15H17N3O4S2/c19-14(20)13-10-16-15(23-13)17-6-8-18(9-7-17)24(21,22)11-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2,(H,19,20) |
| InChIKey | DJKOMYVAVRXXEU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |