C18H20N4O5S3 — CID 172709215
hydroxylamine;2-[4-(4-thiophen-2-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylic acid (PubChem CID 172709215) has the molecular formula C18H20N4O5S3 and a molecular weight of 468.58 g/mol. Its IUPAC name is hydroxylamine;2-[4-(4-thiophen-2-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | hydroxylamine;2-[4-(4-thiophen-2-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 172709215 |
| Molecular Formula | C18H20N4O5S3 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | hydroxylamine;2-[4-(4-thiophen-2-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylic acid |
| SMILES | NO.O=C(O)c1cnc(N2CCN(S(=O)(=O)c3ccc(-c4cccs4)cc3)CC2)s1 |
| InChI | InChI=1S/C18H17N3O4S3.H3NO/c22-17(23)16-12-19-18(27-16)20-7-9-21(10-8-20)28(24,25)14-5-3-13(4-6-14)15-2-1-11-26-15;1-2/h1-6,11-12H,7-10H2,(H,22,23);2H,1H2 |
| InChIKey | FACKETVLCQCIJR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|