C18H23N5O4S2 — CID 11178108
N-hydroxy-2-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide (PubChem CID 11178108) has the molecular formula C18H23N5O4S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is N-hydroxy-2-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-hydroxy-2-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 11178108 |
| Molecular Formula | C18H23N5O4S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-hydroxy-2-[4-(4-pyrrolidin-1-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCN(S(=O)(=O)c3ccc(N4CCCC4)cc3)CC2)s1 |
| InChI | InChI=1S/C18H23N5O4S2/c24-17(20-25)16-13-19-18(28-16)22-9-11-23(12-10-22)29(26,27)15-5-3-14(4-6-15)21-7-1-2-8-21/h3-6,13,25H,1-2,7-12H2,(H,20,24) |
| InChIKey | WYLZQYKUXCBEII-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|