C25H30ClN5O4S2 — CID 157389142
N-hydroxy-2-[4-[4-[3-(pyrrolidin-1-ylmethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide;hydrochloride (PubChem CID 157389142) has the molecular formula C25H30ClN5O4S2 and a molecular weight of 564.13 g/mol. Its IUPAC name is N-hydroxy-2-[4-[4-[3-(pyrrolidin-1-ylmethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-2-[4-[4-[3-(pyrrolidin-1-ylmethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 157389142 |
| Molecular Formula | C25H30ClN5O4S2 |
| Molecular Weight | 564.13 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | N-hydroxy-2-[4-[4-[3-(pyrrolidin-1-ylmethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)c1cnc(N2CCN(S(=O)(=O)c3ccc(-c4cccc(CN5CCCC5)c4)cc3)CC2)s1 |
| InChI | InChI=1S/C25H29N5O4S2.ClH/c31-24(27-32)23-17-26-25(35-23)29-12-14-30(15-13-29)36(33,34)22-8-6-20(7-9-22)21-5-3-4-19(16-21)18-28-10-1-2-11-28;/h3-9,16-17,32H,1-2,10-15,18H2,(H,27,31);1H |
| InChIKey | XUTSJSZVIJHUIX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|