C19H20N4O4S2 — CID 11647693
N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-1,3-thiazole-5-carboxamide (PubChem CID 11647693) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 11647693 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-hydroxy-2-[4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCC(NS(=O)(=O)c3ccc4ccccc4c3)CC2)s1 |
| InChI | InChI=1S/C19H20N4O4S2/c24-18(21-25)17-12-20-19(28-17)23-9-7-15(8-10-23)22-29(26,27)16-6-5-13-3-1-2-4-14(13)11-16/h1-6,11-12,15,22,25H,7-10H2,(H,21,24) |
| InChIKey | XTVZHOVBRQIKLP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|