C22H24IN5O5S2 — CID 160860590
N-hydroxy-2-[(3R,4S)-3-(hydroxymethyl)-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide;methanethioyl iodide (PubChem CID 160860590) has the molecular formula C22H24IN5O5S2 and a molecular weight of 629.50 g/mol. Its IUPAC name is N-hydroxy-2-[(3R,4S)-3-(hydroxymethyl)-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide;methanethioyl iodide.
| Compound Name | N-hydroxy-2-[(3R,4S)-3-(hydroxymethyl)-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide;methanethioyl iodide |
|---|---|
| PubChem CID | 160860590 |
| Molecular Formula | C22H24IN5O5S2 |
| Molecular Weight | 629.50 g/mol |
| Exact Mass | 629.03 |
| IUPAC Name | N-hydroxy-2-[(3R,4S)-3-(hydroxymethyl)-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide;methanethioyl iodide |
| SMILES | O=C(NO)c1cnc(N2CC[C@H](NS(=O)(=O)c3ccc4ccccc4c3)[C@H](CO)C2)nc1.S=CI |
| InChI | InChI=1S/C21H23N5O5S.CHIS/c27-13-17-12-26(21-22-10-16(11-23-21)20(28)24-29)8-7-19(17)25-32(30,31)18-6-5-14-3-1-2-4-15(14)9-18;2-1-3/h1-6,9-11,17,19,25,27,29H,7-8,12-13H2,(H,24,28);1H/t17-,19-;/m0./s1 |
| InChIKey | SKKSIFHCKQXATO-QQTWVUFVSA-N |
| XLogP | 2.29 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|