C19H20N6O5S — CID 58845086
N-hydroxy-4-(hydroxyamino)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide (PubChem CID 58845086) has the molecular formula C19H20N6O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is N-hydroxy-4-(hydroxyamino)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-4-(hydroxyamino)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58845086 |
| Molecular Formula | C19H20N6O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-hydroxy-4-(hydroxyamino)-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)nc1NO |
| InChI | InChI=1S/C19H20N6O5S/c26-18(23-28)16-12-20-19(21-17(16)22-27)24-7-9-25(10-8-24)31(29,30)15-6-5-13-3-1-2-4-14(13)11-15/h1-6,11-12,27-28H,7-10H2,(H,23,26)(H,20,21,22) |
| InChIKey | ANHXKALAHJBPEQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|