C20H20N4O4S — CID 58845099
methyl 6-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyridazine-3-carboxylate (PubChem CID 58845099) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is methyl 6-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 58845099 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | methyl 6-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)nn1 |
| InChI | InChI=1S/C20H20N4O4S/c1-28-20(25)18-8-9-19(22-21-18)23-10-12-24(13-11-23)29(26,27)17-7-6-15-4-2-3-5-16(15)14-17/h2-9,14H,10-13H2,1H3 |
| InChIKey | LZRWISFMMZFSQC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |