C15H14Cl2N4O2 — CID 143666633
2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 143666633) has the molecular formula C15H14Cl2N4O2 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 143666633 |
| Molecular Formula | C15H14Cl2N4O2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCC(c3ccc(Cl)c(Cl)c3)C2)nc1 |
| InChI | InChI=1S/C15H14Cl2N4O2/c16-12-2-1-9(5-13(12)17)10-3-4-21(8-10)15-18-6-11(7-19-15)14(22)20-23/h1-2,5-7,10,23H,3-4,8H2,(H,20,22) |
| InChIKey | SXFRIRSQEZLKMH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|