About 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide
2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 143666633) has the molecular formula C15H14Cl2N4O2
and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| PubChem CID | 143666633 |
| Molecular Formula | C15H14Cl2N4O2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCC(c3ccc(Cl)c(Cl)c3)C2)nc1 |
| InChI | InChI=1S/C15H14Cl2N4O2/c16-12-2-1-9(5-13(12)17)10-3-4-21(8-10)15-18-6-11(7-19-15)14(22)20-23/h1-2,5-7,10,23H,3-4,8H2,(H,20,22) |
| InChIKey | SXFRIRSQEZLKMH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide?
The IUPAC name of 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (CID 143666633) is 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
What is the SMILES notation for 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide?
The canonical SMILES for 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide is O=C(NO)c1cnc(N2CCC(c3ccc(Cl)c(Cl)c3)C2)nc1.
What is the InChIKey of 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide?
The InChIKey is SXFRIRSQEZLKMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N4O2/c16-12-2-1-9(5-13(12)17)10-3-4-21(8-10)15-18-6-11(7-19-15)14(22)20-23/h1-2,5-7,10,23H,3-4,8H2,(H,20,22).
What are the key properties of 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide?
2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide has a molecular weight of 353.21 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-N-hydroxypyrimidine-5-carboxamide is sourced from PubChem (CID 143666633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).