C23H27Cl2NO4 — CID 57072970
[3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 57072970) has the molecular formula C23H27Cl2NO4 and a molecular weight of 452.38 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 57072970 |
| Molecular Formula | C23H27Cl2NO4 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | [3-(3,4-dichlorophenyl)pyrrolidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCC(c3ccc(Cl)c(Cl)c3)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H27Cl2NO4/c1-4-28-20-12-17(13-21(29-5-2)22(20)30-6-3)23(27)26-10-9-16(14-26)15-7-8-18(24)19(25)11-15/h7-8,11-13,16H,4-6,9-10,14H2,1-3H3 |
| InChIKey | BZCROKDVRZJLRI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |