C22H26ClN5O2 — CID 160914774
2-[4-[[2-(6-chloro-3H-inden-1-yl)ethylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 160914774) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 2-[4-[[2-(6-chloro-3H-inden-1-yl)ethylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[[2-(6-chloro-3H-inden-1-yl)ethylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 160914774 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[4-[[2-(6-chloro-3H-inden-1-yl)ethylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCC(CNCCC3=CCc4ccc(Cl)cc43)CC2)nc1 |
| InChI | InChI=1S/C22H26ClN5O2/c23-19-4-3-16-1-2-17(20(16)11-19)5-8-24-12-15-6-9-28(10-7-15)22-25-13-18(14-26-22)21(29)27-30/h2-4,11,13-15,24,30H,1,5-10,12H2,(H,27,29) |
| InChIKey | SRGITGQDLFBPNS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|