C21H25FN6O2 — CID 11589660
2-[4-[[(7-fluoro-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 11589660) has the molecular formula C21H25FN6O2 and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[4-[[(7-fluoro-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[4-[[(7-fluoro-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11589660 |
| Molecular Formula | C21H25FN6O2 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[4-[[(7-fluoro-1-methylindol-3-yl)methylamino]methyl]piperidin-1-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | Cn1cc(CNCC2CCN(c3ncc(C(=O)NO)cn3)CC2)c2cccc(F)c21 |
| InChI | InChI=1S/C21H25FN6O2/c1-27-13-16(17-3-2-4-18(22)19(17)27)10-23-9-14-5-7-28(8-6-14)21-24-11-15(12-25-21)20(29)26-30/h2-4,11-14,23,30H,5-10H2,1H3,(H,26,29) |
| InChIKey | MQQVRWRSFHIEHT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|