C21H22N6O3 — CID 59367689
N-hydroxy-2-[6-[[2-(1-methylindol-3-yl)acetyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide (PubChem CID 59367689) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-hydroxy-2-[6-[[2-(1-methylindol-3-yl)acetyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[6-[[2-(1-methylindol-3-yl)acetyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59367689 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-hydroxy-2-[6-[[2-(1-methylindol-3-yl)acetyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide |
| SMILES | Cn1cc(CC(=O)NC2C3CN(c4ncc(C(=O)NO)cn4)CC32)c2ccccc21 |
| InChI | InChI=1S/C21H22N6O3/c1-26-9-12(14-4-2-3-5-17(14)26)6-18(28)24-19-15-10-27(11-16(15)19)21-22-7-13(8-23-21)20(29)25-30/h2-5,7-9,15-16,19,30H,6,10-11H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | WVCYMEWWPDTCRZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|