C21H24N6O3 — CID 175184641
N-hydroxy-2-[6-[(5-methoxy-1-methylindol-3-yl)methyl]-2,6-diazaspiro[3.3]heptan-2-yl]pyrimidine-5-carboxamide (PubChem CID 175184641) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-hydroxy-2-[6-[(5-methoxy-1-methylindol-3-yl)methyl]-2,6-diazaspiro[3.3]heptan-2-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[6-[(5-methoxy-1-methylindol-3-yl)methyl]-2,6-diazaspiro[3.3]heptan-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 175184641 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-hydroxy-2-[6-[(5-methoxy-1-methylindol-3-yl)methyl]-2,6-diazaspiro[3.3]heptan-2-yl]pyrimidine-5-carboxamide |
| SMILES | COc1ccc2c(c1)c(CN1CC3(C1)CN(c1ncc(C(=O)NO)cn1)C3)cn2C |
| InChI | InChI=1S/C21H24N6O3/c1-25-8-15(17-5-16(30-2)3-4-18(17)25)9-26-10-21(11-26)12-27(13-21)20-22-6-14(7-23-20)19(28)24-29/h3-8,29H,9-13H2,1-2H3,(H,24,28) |
| InChIKey | GSTOAZLFPSUMIM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|