C20H28N4O4 — CID 90768051
butyl 4-[[5-(hydroxycarbamoyl)-1-methylindol-3-yl]methyl]piperazine-1-carboxylate (PubChem CID 90768051) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is butyl 4-[[5-(hydroxycarbamoyl)-1-methylindol-3-yl]methyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[[5-(hydroxycarbamoyl)-1-methylindol-3-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90768051 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | butyl 4-[[5-(hydroxycarbamoyl)-1-methylindol-3-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(Cc2cn(C)c3ccc(C(=O)NO)cc23)CC1 |
| InChI | InChI=1S/C20H28N4O4/c1-3-4-11-28-20(26)24-9-7-23(8-10-24)14-16-13-22(2)18-6-5-15(12-17(16)18)19(25)21-27/h5-6,12-13,27H,3-4,7-11,14H2,1-2H3,(H,21,25) |
| InChIKey | FICYKPMFTBDFKS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|