C23H28N6O2 — CID 162666012
N-hydroxy-2-[2-[(1-methylindol-3-yl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide (PubChem CID 162666012) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-hydroxy-2-[2-[(1-methylindol-3-yl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[2-[(1-methylindol-3-yl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 162666012 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | N-hydroxy-2-[2-[(1-methylindol-3-yl)methyl]-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide |
| SMILES | Cn1cc(CN2CCC3(CCN(c4ncc(C(=O)NO)cn4)CC3)C2)c2ccccc21 |
| InChI | InChI=1S/C23H28N6O2/c1-27-14-18(19-4-2-3-5-20(19)27)15-28-9-6-23(16-28)7-10-29(11-8-23)22-24-12-17(13-25-22)21(30)26-31/h2-5,12-14,31H,6-11,15-16H2,1H3,(H,26,30) |
| InChIKey | HHBZHABWLHQPRG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|