C23H26N6O2 — CID 162648420
N-hydroxy-2-[2-(isoquinolin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide (PubChem CID 162648420) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-hydroxy-2-[2-(isoquinolin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[2-(isoquinolin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 162648420 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N-hydroxy-2-[2-(isoquinolin-4-ylmethyl)-2,8-diazaspiro[4.5]decan-8-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCC3(CCN(Cc4cncc5ccccc45)C3)CC2)nc1 |
| InChI | InChI=1S/C23H26N6O2/c30-21(27-31)18-13-25-22(26-14-18)29-9-6-23(7-10-29)5-8-28(16-23)15-19-12-24-11-17-3-1-2-4-20(17)19/h1-4,11-14,31H,5-10,15-16H2,(H,27,30) |
| InChIKey | JVNPJUOLECVPMR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|