C23H29NO4S — CID 18797896
(E)-7-[2-(naphthalen-2-ylsulfonylamino)cyclohexyl]hept-5-enoic acid (PubChem CID 18797896) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is (E)-7-[2-(naphthalen-2-ylsulfonylamino)cyclohexyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-(naphthalen-2-ylsulfonylamino)cyclohexyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 18797896 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (E)-7-[2-(naphthalen-2-ylsulfonylamino)cyclohexyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1CCCCC1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H29NO4S/c25-23(26)14-4-2-1-3-10-19-11-7-8-13-22(19)24-29(27,28)21-16-15-18-9-5-6-12-20(18)17-21/h1,3,5-6,9,12,15-17,19,22,24H,2,4,7-8,10-11,13-14H2,(H,25,26)/b3-1+ |
| InChIKey | GMFRNHGPLNJKTJ-HNQUOIGGSA-N |
| XLogP | 4.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|