C20H26FNO4S — CID 18798004
(E)-7-[2-[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylamino]cyclopentyl]hept-5-enoic acid (PubChem CID 18798004) has the molecular formula C20H26FNO4S and a molecular weight of 395.50 g/mol. Its IUPAC name is (E)-7-[2-[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylamino]cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylamino]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 18798004 |
| Molecular Formula | C20H26FNO4S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (E)-7-[2-[[(E)-2-(4-fluorophenyl)ethenyl]sulfonylamino]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1CCCC1NS(=O)(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FNO4S/c21-18-12-10-16(11-13-18)14-15-27(25,26)22-19-8-5-7-17(19)6-3-1-2-4-9-20(23)24/h1,3,10-15,17,19,22H,2,4-9H2,(H,23,24)/b3-1+,15-14+ |
| InChIKey | JTGBRSJDKIJFCG-ONEZXHGESA-N |
| XLogP | 4.09 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|