C19H24ClNO4S — CID 18798010
(E)-6-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]cyclopentyl]hex-5-enoic acid (PubChem CID 18798010) has the molecular formula C19H24ClNO4S and a molecular weight of 397.92 g/mol. Its IUPAC name is (E)-6-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]cyclopentyl]hex-5-enoic acid.
| Compound Name | (E)-6-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]cyclopentyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 18798010 |
| Molecular Formula | C19H24ClNO4S |
| Molecular Weight | 397.92 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (E)-6-[3-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]cyclopentyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/C1CCC(NS(=O)(=O)/C=C/c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H24ClNO4S/c20-17-9-6-15(7-10-17)12-13-26(24,25)21-18-11-8-16(14-18)4-2-1-3-5-19(22)23/h2,4,6-7,9-10,12-13,16,18,21H,1,3,5,8,11,14H2,(H,22,23)/b4-2+,13-12+ |
| InChIKey | KFAHSMTUSRZTHR-ZCMUBXDESA-N |
| XLogP | 4.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|