C21H29ClN2O6S — CID 15670384
(Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]hex-5-enoic acid (PubChem CID 15670384) has the molecular formula C21H29ClN2O6S and a molecular weight of 472.99 g/mol. Its IUPAC name is (Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 15670384 |
| Molecular Formula | C21H29ClN2O6S |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]hex-5-enoic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NS(=O)(=O)c2ccc(Cl)cc2)C[C@H]1/C=C\CCCC(=O)O |
| InChI | InChI=1S/C21H29ClN2O6S/c1-21(2,3)30-20(27)24-14-16(13-17(24)7-5-4-6-8-19(25)26)23-31(28,29)18-11-9-15(22)10-12-18/h5,7,9-12,16-17,23H,4,6,8,13-14H2,1-3H3,(H,25,26)/b7-5-/t16-,17-/m1/s1 |
| InChIKey | ZBDBHYTUDPQXIG-BJESKFFQSA-N |
| XLogP | 3.81 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|