C23H26Cl2N2O4S — CID 15670474
(Z)-6-[(2S,4R)-1-[(2-chlorophenyl)methyl]-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid (PubChem CID 15670474) has the molecular formula C23H26Cl2N2O4S and a molecular weight of 497.44 g/mol. Its IUPAC name is (Z)-6-[(2S,4R)-1-[(2-chlorophenyl)methyl]-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(2S,4R)-1-[(2-chlorophenyl)methyl]-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 15670474 |
| Molecular Formula | C23H26Cl2N2O4S |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (Z)-6-[(2S,4R)-1-[(2-chlorophenyl)methyl]-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H26Cl2N2O4S/c24-18-10-12-21(13-11-18)32(30,31)26-19-14-20(7-2-1-3-9-23(28)29)27(16-19)15-17-6-4-5-8-22(17)25/h2,4-8,10-13,19-20,26H,1,3,9,14-16H2,(H,28,29)/b7-2-/t19-,20-/m1/s1 |
| InChIKey | MGEIPJRQYIYOSP-UTYRDINASA-N |
| XLogP | 4.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|