C28H31ClN2O4S — CID 57205892
methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(naphthalen-1-ylmethyl)pyrrolidin-2-yl]hex-5-enoate (PubChem CID 57205892) has the molecular formula C28H31ClN2O4S and a molecular weight of 527.09 g/mol. Its IUPAC name is methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(naphthalen-1-ylmethyl)pyrrolidin-2-yl]hex-5-enoate.
| Compound Name | methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(naphthalen-1-ylmethyl)pyrrolidin-2-yl]hex-5-enoate |
|---|---|
| PubChem CID | 57205892 |
| Molecular Formula | C28H31ClN2O4S |
| Molecular Weight | 527.09 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(naphthalen-1-ylmethyl)pyrrolidin-2-yl]hex-5-enoate |
| SMILES | COC(=O)CCCC=C[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H31ClN2O4S/c1-35-28(32)13-4-2-3-11-25-18-24(30-36(33,34)26-16-14-23(29)15-17-26)20-31(25)19-22-10-7-9-21-8-5-6-12-27(21)22/h3,5-12,14-17,24-25,30H,2,4,13,18-20H2,1H3/t24-,25-/m1/s1 |
| InChIKey | AGSINGVSANXLIS-JWQCQUIFSA-N |
| XLogP | 5.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.09 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|