C21H24ClN3O4S — CID 57135082
5-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]pent-4-enoic acid (PubChem CID 57135082) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 5-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]pent-4-enoic acid.
| Compound Name | 5-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 57135082 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 5-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]pent-4-enoic acid |
| SMILES | O=C(O)CCC=C[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1Cc1cccnc1 |
| InChI | InChI=1S/C21H24ClN3O4S/c22-17-7-9-20(10-8-17)30(28,29)24-18-12-19(5-1-2-6-21(26)27)25(15-18)14-16-4-3-11-23-13-16/h1,3-5,7-11,13,18-19,24H,2,6,12,14-15H2,(H,26,27)/t18-,19-/m1/s1 |
| InChIKey | WGDVUTRRUWTNET-RTBURBONSA-N |
| XLogP | 3.08 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|