C23H27ClN2O6S2 — CID 67864093
(Z)-6-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-methylphenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid (PubChem CID 67864093) has the molecular formula C23H27ClN2O6S2 and a molecular weight of 527.06 g/mol. Its IUPAC name is (Z)-6-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-methylphenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-methylphenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 67864093 |
| Molecular Formula | C23H27ClN2O6S2 |
| Molecular Weight | 527.06 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | (Z)-6-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-methylphenyl)sulfonylamino]pyrrolidin-2-yl]hex-5-enoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2C[C@@H](/C=C\CCCC(=O)O)N(S(=O)(=O)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C23H27ClN2O6S2/c1-17-7-11-21(12-8-17)33(29,30)25-19-15-20(5-3-2-4-6-23(27)28)26(16-19)34(31,32)22-13-9-18(24)10-14-22/h3,5,7-14,19-20,25H,2,4,6,15-16H2,1H3,(H,27,28)/b5-3-/t19-,20-/m1/s1 |
| InChIKey | HXHCWDNZQHJSOG-NFYQCCHDSA-N |
| XLogP | 3.57 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.06 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|