C21H23BrCl2N2O4S2 — CID 57224007
N-[(3R,5S)-5-(5-bromopent-1-enyl)-1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]-4-chlorobenzenesulfonamide (PubChem CID 57224007) has the molecular formula C21H23BrCl2N2O4S2 and a molecular weight of 582.37 g/mol. Its IUPAC name is N-[(3R,5S)-5-(5-bromopent-1-enyl)-1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[(3R,5S)-5-(5-bromopent-1-enyl)-1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 57224007 |
| Molecular Formula | C21H23BrCl2N2O4S2 |
| Molecular Weight | 582.37 g/mol |
| Exact Mass | 579.97 |
| IUPAC Name | N-[(3R,5S)-5-(5-bromopent-1-enyl)-1-(4-chlorophenyl)sulfonylpyrrolidin-3-yl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1C[C@@H](C=CCCCBr)N(S(=O)(=O)c2ccc(Cl)cc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23BrCl2N2O4S2/c22-13-3-1-2-4-19-14-18(25-31(27,28)20-9-5-16(23)6-10-20)15-26(19)32(29,30)21-11-7-17(24)8-12-21/h2,4-12,18-19,25H,1,3,13-15H2/t18-,19-/m1/s1 |
| InChIKey | MMGACIUXFHUHHS-RTBURBONSA-N |
| XLogP | 4.83 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|