C22H28ClN3O4S — CID 57214613
methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(1H-pyrrol-2-ylmethyl)pyrrolidin-2-yl]hex-5-enoate (PubChem CID 57214613) has the molecular formula C22H28ClN3O4S and a molecular weight of 466.00 g/mol. Its IUPAC name is methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(1H-pyrrol-2-ylmethyl)pyrrolidin-2-yl]hex-5-enoate.
| Compound Name | methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(1H-pyrrol-2-ylmethyl)pyrrolidin-2-yl]hex-5-enoate |
|---|---|
| PubChem CID | 57214613 |
| Molecular Formula | C22H28ClN3O4S |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | methyl 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(1H-pyrrol-2-ylmethyl)pyrrolidin-2-yl]hex-5-enoate |
| SMILES | COC(=O)CCCC=C[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1Cc1ccc[nH]1 |
| InChI | InChI=1S/C22H28ClN3O4S/c1-30-22(27)8-4-2-3-7-20-14-19(16-26(20)15-18-6-5-13-24-18)25-31(28,29)21-11-9-17(23)10-12-21/h3,5-7,9-13,19-20,24-25H,2,4,8,14-16H2,1H3/t19-,20-/m1/s1 |
| InChIKey | UJHOXYPDWLRJMY-WOJBJXKFSA-N |
| XLogP | 3.49 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|