C26H28ClN3O4S — CID 57184992
6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]hex-5-enoic acid (PubChem CID 57184992) has the molecular formula C26H28ClN3O4S and a molecular weight of 514.05 g/mol. Its IUPAC name is 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]hex-5-enoic acid.
| Compound Name | 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 57184992 |
| Molecular Formula | C26H28ClN3O4S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]hex-5-enoic acid |
| SMILES | O=C(O)CCCC=C[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C26H28ClN3O4S/c27-21-10-12-24(13-11-21)35(33,34)29-22-15-23(7-2-1-3-9-26(31)32)30(18-22)17-19-14-20-6-4-5-8-25(20)28-16-19/h2,4-8,10-14,16,22-23,29H,1,3,9,15,17-18H2,(H,31,32)/t22-,23-/m1/s1 |
| InChIKey | UKRFSCBHSMWEJE-DHIUTWEWSA-N |
| XLogP | 4.62 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|