C25H31ClN2O4S — CID 15670432
(Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(3-phenylpropyl)pyrrolidin-2-yl]hex-5-enoic acid (PubChem CID 15670432) has the molecular formula C25H31ClN2O4S and a molecular weight of 491.05 g/mol. Its IUPAC name is (Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(3-phenylpropyl)pyrrolidin-2-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(3-phenylpropyl)pyrrolidin-2-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 15670432 |
| Molecular Formula | C25H31ClN2O4S |
| Molecular Weight | 491.05 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | (Z)-6-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(3-phenylpropyl)pyrrolidin-2-yl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1CCCc1ccccc1 |
| InChI | InChI=1S/C25H31ClN2O4S/c26-21-13-15-24(16-14-21)33(31,32)27-22-18-23(11-5-2-6-12-25(29)30)28(19-22)17-7-10-20-8-3-1-4-9-20/h1,3-5,8-9,11,13-16,22-23,27H,2,6-7,10,12,17-19H2,(H,29,30)/b11-5-/t22-,23-/m1/s1 |
| InChIKey | HQBCKQQUZUCDSZ-GFYYSSBESA-N |
| XLogP | 4.51 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.05 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|