C24H30ClN3O4S — CID 15670456
methyl (Z)-7-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]hept-6-enoate (PubChem CID 15670456) has the molecular formula C24H30ClN3O4S and a molecular weight of 492.04 g/mol. Its IUPAC name is methyl (Z)-7-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]hept-6-enoate.
| Compound Name | methyl (Z)-7-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]hept-6-enoate |
|---|---|
| PubChem CID | 15670456 |
| Molecular Formula | C24H30ClN3O4S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | methyl (Z)-7-[(2S,4R)-4-[(4-chlorophenyl)sulfonylamino]-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]hept-6-enoate |
| SMILES | COC(=O)CCCC/C=C\[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1Cc1cccnc1 |
| InChI | InChI=1S/C24H30ClN3O4S/c1-32-24(29)9-5-3-2-4-8-22-15-21(18-28(22)17-19-7-6-14-26-16-19)27-33(30,31)23-12-10-20(25)11-13-23/h4,6-8,10-14,16,21-22,27H,2-3,5,9,15,17-18H2,1H3/b8-4-/t21-,22-/m1/s1 |
| InChIKey | LVTZHYQITQUOTL-YSXZVRBFSA-N |
| XLogP | 3.95 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|