C21H22Cl2N2O6S2 — CID 67863392
ethyl (E)-3-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]prop-2-enoate (PubChem CID 67863392) has the molecular formula C21H22Cl2N2O6S2 and a molecular weight of 533.46 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67863392 |
| Molecular Formula | C21H22Cl2N2O6S2 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | ethyl (E)-3-[(2S,4R)-1-(4-chlorophenyl)sulfonyl-4-[(4-chlorophenyl)sulfonylamino]pyrrolidin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1C[C@@H](NS(=O)(=O)c2ccc(Cl)cc2)CN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22Cl2N2O6S2/c1-2-31-21(26)12-7-18-13-17(24-32(27,28)19-8-3-15(22)4-9-19)14-25(18)33(29,30)20-10-5-16(23)6-11-20/h3-12,17-18,24H,2,13-14H2,1H3/b12-7+/t17-,18-/m1/s1 |
| InChIKey | RMUVREJJVCSIJP-KYIQILLBSA-N |
| XLogP | 3.22 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|