C9H11ClN2O2S — CID 66187951
N-(azetidin-3-yl)-4-chlorobenzenesulfonamide (PubChem CID 66187951) has the molecular formula C9H11ClN2O2S and a molecular weight of 246.72 g/mol. Its IUPAC name is N-(azetidin-3-yl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(azetidin-3-yl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 66187951 |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | N-(azetidin-3-yl)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CNC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H11ClN2O2S/c10-7-1-3-9(4-2-7)15(13,14)12-8-5-11-6-8/h1-4,8,11-12H,5-6H2 |
| InChIKey | PBQUPLISIKRTKC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |