About 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide
4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide (PubChem CID 11859488) has the molecular formula C14H20ClN2O2S+
and a molecular weight of 315.85 g/mol. Its IUPAC name is 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide |
| PubChem CID | 11859488 |
| Molecular Formula | C14H20ClN2O2S+ |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide |
| SMILES | C[NH+]1[C@@H]2CC[C@H]1CC(NS(=O)(=O)c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C14H19ClN2O2S/c1-17-12-4-5-13(17)9-11(8-12)16-20(18,19)14-6-2-10(15)3-7-14/h2-3,6-7,11-13,16H,4-5,8-9H2,1H3/p+1/t11?,12-,13+ |
| InChIKey | XHRMLNQFHNAKTQ-YHWZYXNKSA-O |
| XLogP | 0.83 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide?
The IUPAC name of 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide (CID 11859488) is 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide.
What is the SMILES notation for 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide?
The canonical SMILES for 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide is C[NH+]1[C@@H]2CC[C@H]1CC(NS(=O)(=O)c1ccc(Cl)cc1)C2.
What is the InChIKey of 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide?
The InChIKey is XHRMLNQFHNAKTQ-YHWZYXNKSA-O. The full InChI is InChI=1S/C14H19ClN2O2S/c1-17-12-4-5-13(17)9-11(8-12)16-20(18,19)14-6-2-10(15)3-7-14/h2-3,6-7,11-13,16H,4-5,8-9H2,1H3/p+1/t11?,12-,13+.
What are the key properties of 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide?
4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide has a molecular weight of 315.85 g/mol, XLogP of 0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]benzenesulfonamide is sourced from PubChem (CID 11859488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).